3-Nitro-6-[2-(triMethylsilyl)ethoxy]pyridine-2-acetonitrile
Modify Date: 2025-08-25 21:54:00
![3-Nitro-6-[2-(triMethylsilyl)ethoxy]pyridine-2-acetonitrile Structure](https://image.chemsrc.com/caspic/437/361456-00-0.png)
3-Nitro-6-[2-(triMethylsilyl)ethoxy]pyridine-2-acetonitrile structure
|
Common Name | 3-Nitro-6-[2-(triMethylsilyl)ethoxy]pyridine-2-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 361456-00-0 | Molecular Weight | 279.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17N3O3Si | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 2-[3-nitro-6-(2-trimethylsilylethoxy)pyridin-2-yl]acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17N3O3Si |
|---|---|
| Molecular Weight | 279.36700 |
| Exact Mass | 279.10400 |
| PSA | 91.73000 |
| LogP | 3.29608 |
| InChIKey | ZELXOZMZOFEIFO-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOc1ccc([N+](=O)[O-])c(CC#N)n1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| RIDADR | UN 2811 6.1 / PGIII |
|
~84%
3-Nitro-6-[2-(t... CAS#:361456-00-0 |
| Literature: Papageorgiou, Christos; Camenisch, Gian; Borer, Xaver Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 12 p. 1549 - 1552 |
|
~%
3-Nitro-6-[2-(t... CAS#:361456-00-0 |
| Literature: Papageorgiou, Christos; Camenisch, Gian; Borer, Xaver Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 12 p. 1549 - 1552 |
|
~%
3-Nitro-6-[2-(t... CAS#:361456-00-0 |
| Literature: Papageorgiou, Christos; Camenisch, Gian; Borer, Xaver Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 12 p. 1549 - 1552 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Nitro-6-[2-(trimethylsilyl)ethoxy]pyridine-2-acetonitrile |