4-n-Octyloxyphenyl 4-Butylbenzoate
Modify Date: 2025-08-25 06:38:16
4-n-Octyloxyphenyl 4-Butylbenzoate structure
|
Common Name | 4-n-Octyloxyphenyl 4-Butylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 42815-59-8 | Molecular Weight | 382.53600 | |
| Density | 1.011g/cm3 | Boiling Point | 503.6ºC at 760 mmHg | |
| Molecular Formula | C25H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
| Name | (4-octoxyphenyl) 4-butylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.011g/cm3 |
|---|---|
| Boiling Point | 503.6ºC at 760 mmHg |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.53600 |
| Flash Point | 218.1ºC |
| Exact Mass | 382.25100 |
| PSA | 35.53000 |
| LogP | 6.98770 |
| Index of Refraction | 1.524 |
| InChIKey | DESAJRHSCPKXHK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(OC(=O)c2ccc(CCCC)cc2)cc1 |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2916399090 |
|
~%
4-n-Octyloxyphe... CAS#:42815-59-8 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. 320, p. 191 - 205 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Butylbenzoic Acid 4-n-Octyloxyphenyl Ester |
| 4-OCTYLOXYPHENYL 4-BUTYLBENZOATE |
| 4-n-Octyloxyphenyl 4-Butylbenzoate [Liquid Crystal] |
| B1092 |
| 4'-N-OCTYLOXYPHENYL 4-BUTYLBENZOATE |
| 4-n-Octyloxyphenyl 4-Butylbenzoate |