4-methyl-1-(4-methyl-2-nitro-phenyl)sulfanyldisulfanyl-2-nitro-benzene
Modify Date: 2025-10-04 17:28:31
4-methyl-1-(4-methyl-2-nitro-phenyl)sulfanyldisulfanyl-2-nitro-benzene structure
|
Common Name | 4-methyl-1-(4-methyl-2-nitro-phenyl)sulfanyldisulfanyl-2-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 4274-36-6 | Molecular Weight | 368.45100 | |
| Density | 1.49g/cm3 | Boiling Point | 554.5ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.1ºC | |
| Name | 4-methyl-1-[(4-methyl-2-nitrophenyl)trisulfanyl]-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 554.5ºC at 760 mmHg |
| Molecular Formula | C14H12N2O4S3 |
| Molecular Weight | 368.45100 |
| Flash Point | 289.1ºC |
| Exact Mass | 367.99600 |
| PSA | 167.54000 |
| LogP | 6.61380 |
| Index of Refraction | 1.712 |
| InChIKey | MPMPHGGLUUGUFU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SSSc2ccc(C)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
4-methyl-1-(4-m... CAS#:4274-36-6 |
| Literature: Tularik Inc. Patent: US2003/139390 A1, 2003 ; US 20030139390 A1 |
|
~%
4-methyl-1-(4-m... CAS#:4274-36-6 |
| Literature: Dannley,R.L.; Zazaris,D.A. Canadian Journal of Chemistry, 1965 , vol. 43, p. 2610 - 2612 |
|
~%
4-methyl-1-(4-m... CAS#:4274-36-6 |
| Literature: Pitombo,L.R.M. Chemische Berichte, 1962 , vol. 95, p. 2960 - 2963 |
|
~%
4-methyl-1-(4-m... CAS#:4274-36-6 |
| Literature: Pitombo,L.R.M. Chemische Berichte, 1962 , vol. 95, p. 2960 - 2963 |
CAS#:31183-81-0| 2,2'-Dinitro-4,4'-dimethyl-diphenyltrisulfid |
| Bis-<4-methyl-2-nitro-phenyl>-trisulfid |