bis[2-(2-methylprop-2-enoyloxy)ethyl] hexanedioate structure
|
Common Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 4272-13-3 | Molecular Weight | 370.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[2-(2-methylprop-2-enoyloxy)ethyl] hexanedioate |
|---|
| Molecular Formula | C18H26O8 |
|---|---|
| Molecular Weight | 370.39400 |
| Exact Mass | 370.16300 |
| PSA | 105.20000 |
| LogP | 1.87180 |
| InChIKey | LDCRDNMXNWMORR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCCCC(=O)OCCOC(=O)C(=C)C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |