dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(oxiran-2-ylmethyl)azanium,methyl prop-2-enoate,chloride structure
|
Common Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(oxiran-2-ylmethyl)azanium,methyl prop-2-enoate,chloride | ||
|---|---|---|---|---|
| CAS Number | 65859-28-1 | Molecular Weight | 335.82400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(oxiran-2-ylmethyl)azanium,methyl prop-2-enoate,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H26ClNO5 |
|---|---|
| Molecular Weight | 335.82400 |
| Exact Mass | 335.15000 |
| PSA | 65.13000 |
| InChIKey | AZKKHEQLSQSULF-UHFFFAOYSA-M |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CC1CO1.C=CC(=O)OC.[Cl-] |
| dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]-(oxiran-2-ylmethyl)azanium |
| Oxiranemethanaminium,N,N-dimethyl-N-(2-((2-methyl-1-oxo-2-propenyl)oxy)ethyl)-,chloride,polymer with methyl 2-propenoate |
| 2-Oxiranemethanaminium,N,N-dimethyl-N-(2-((2-methyl-1-oxo-2-propen-1-yl)oxy)ethyl)-,chloride (1:1),polymer with methyl 2-propenoate |