(Z)-3-[(3-methylphenyl)carbamoyl]prop-2-enoic acid
Modify Date: 2025-09-12 18:39:47
![(Z)-3-[(3-methylphenyl)carbamoyl]prop-2-enoic acid Structure](https://image.chemsrc.com/caspic/164/42537-50-8.png)
(Z)-3-[(3-methylphenyl)carbamoyl]prop-2-enoic acid structure
|
Common Name | (Z)-3-[(3-methylphenyl)carbamoyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 42537-50-8 | Molecular Weight | 205.21000 | |
| Density | 1.282g/cm3 | Boiling Point | 444ºC at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | (Z)-4-(3-methylanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760 mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21000 |
| Flash Point | 222.3ºC |
| Exact Mass | 205.07400 |
| PSA | 66.40000 |
| LogP | 1.64730 |
| Index of Refraction | 1.62 |
| InChIKey | GTNDLSMAJWWVCH-WAYWQWQTSA-N |
| SMILES | Cc1cccc(NC(=O)C=CC(=O)O)c1 |
| HS Code | 2924299090 |
|---|
|
~95%
(Z)-3-[(3-methy... CAS#:42537-50-8 |
| Literature: Kumar, Baldev; Verma, Raman K.; Singh, Harjit Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 692 - 696 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:20299-79-0| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-m-Tolylcarbamoyl-acrylic acid |
| N-m-tolyl-maleamic acid |
| 3'-methyl maleianilic acid |
| Maleinsaeure-mono-m-toluidid |
| F0856-0038 |