(Z)-3-[(2-chlorophenyl)carbamoyl]prop-2-enoic acid structure
|
Common Name | (Z)-3-[(2-chlorophenyl)carbamoyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 53616-16-3 | Molecular Weight | 225.62800 | |
| Density | 1.448g/cm3 | Boiling Point | 459.8ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
| Name | (Z)-4-(2-chloroanilino)-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 459.8ºC at 760 mmHg |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.62800 |
| Flash Point | 231.9ºC |
| Exact Mass | 225.01900 |
| PSA | 66.40000 |
| LogP | 1.99230 |
| Index of Refraction | 1.642 |
| InChIKey | YZGAQJUBGHWISG-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~98%
(Z)-3-[(2-chlor... CAS#:53616-16-3 |
| Literature: Miller, Christopher W.; Hoyle, Charles E.; Valente, Edward J.; Magers, David H.; Joensson, E. Sonny Journal of Physical Chemistry A, 1999 , vol. 103, # 32 p. 6406 - 6412 |
|
~%
(Z)-3-[(2-chlor... CAS#:53616-16-3 |
| Literature: Herz Journal of the American Chemical Society, 1945 , vol. 67, p. 1854 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2'-chloromaleanilic acid |
| Maleinsaeure-mono-o-chlor-anilid |
| F0777-0981 |
| 2'-chloro maleianilic acid |
| Ho~L`BfwBHrJJIKPiQa``afXABh |
| N-chlorophenylmaleamic acid |