1,2-BIS(PHENYL)-1,1,2,2-TETRAFLUOROETHANE structure
|
Common Name | 1,2-BIS(PHENYL)-1,1,2,2-TETRAFLUOROETHANE | ||
|---|---|---|---|---|
| CAS Number | 425-32-1 | Molecular Weight | 254.22300 | |
| Density | 1.231g/cm3 | Boiling Point | 256.8ºC at 760mmHg | |
| Molecular Formula | C14H10F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.1ºC | |
| Name | (1,1,2,2-tetrafluoro-2-phenylethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 256.8ºC at 760mmHg |
| Molecular Formula | C14H10F4 |
| Molecular Weight | 254.22300 |
| Flash Point | 97.1ºC |
| Exact Mass | 254.07200 |
| LogP | 4.57040 |
| Vapour Pressure | 0.0243mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | OVEWNBYMFPGNRR-UHFFFAOYSA-N |
| SMILES | FC(F)(c1ccccc1)C(F)(F)c1ccccc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 24/25 |
| HS Code | 2903999090 |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1,2,2-tetrafluorodiphenylethane |
| 1,1,2,2-Tetrafluoro-1,2-diphenylethane |
| 1,2-Diphenyl-1,1,2,2-tetrafluoroethane |
| 1,1,2,2-Tetrafluor-1,2-diphenyl-aethan |
| Benzene,1,1'-(1,1,2,2-tetrafluoro-1,2-ethanediyl)bis |
| PC2238 |
| 1,2-diphenyltetrafluoroethane |