ethyl 5-(4-methylphenyl)-5-oxopentanoate
Modify Date: 2025-09-13 18:21:15
ethyl 5-(4-methylphenyl)-5-oxopentanoate structure
|
Common Name | ethyl 5-(4-methylphenyl)-5-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 42482-94-0 | Molecular Weight | 234.29100 | |
| Density | 1.049g/cm3 | Boiling Point | 358.4ºC at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.1ºC | |
| Name | ethyl 5-(4-methylphenyl)-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 358.4ºC at 760 mmHg |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29100 |
| Flash Point | 157.1ºC |
| Exact Mass | 234.12600 |
| PSA | 43.37000 |
| LogP | 2.91110 |
| Index of Refraction | 1.503 |
| InChIKey | ZFQBLTUWFXVZLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCC(=O)c1ccc(C)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-oxo-5-p-tolyl-valeric acid ethyl ester |
| ethyl 5-oxo-5-(p-tolyl)pentanoate |
| ETHYL 5-(4-METHYLPHENYL)-5-OXOVALERATE |
| 5-Oxo-5-p-tolyl-valeriansaeure-aethylester |