1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol structure
|
Common Name | 1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 424-82-8 | Molecular Weight | 438.41400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H18F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,2,2-tetrakis(4-fluorophenyl)ethane-1,2-diol |
|---|
| Molecular Formula | C26H18F4O2 |
|---|---|
| Molecular Weight | 438.41400 |
| Exact Mass | 438.12400 |
| PSA | 40.46000 |
| LogP | 5.41500 |
| InChIKey | WCLDEYLDJTVXII-UHFFFAOYSA-N |
| SMILES | OC(c1ccc(F)cc1)(c1ccc(F)cc1)C(O)(c1ccc(F)cc1)c1ccc(F)cc1 |
| HS Code | 2906299090 |
|---|
|
~95%
1,1,2,2-tetraki... CAS#:424-82-8 |
| Literature: Wang, Chunyan; Pan, Yuanjiang; Wu, Anxin Tetrahedron, 2007 , vol. 63, # 2 p. 429 - 434 |
|
~%
1,1,2,2-tetraki... CAS#:424-82-8 |
| Literature: Bradlow; VanderWerf Journal of the American Chemical Society, 1947 , vol. 69, p. 662 |
|
~%
1,1,2,2-tetraki... CAS#:424-82-8 |
| Literature: Bradlow; VanderWerf Journal of the American Chemical Society, 1947 , vol. 69, p. 662 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |