resveratrol triacetate structure
|
Common Name | resveratrol triacetate | ||
|---|---|---|---|---|
| CAS Number | 42206-94-0 | Molecular Weight | 354.353 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 504.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O6 | Melting Point | 117.0 to 121.0 °C | |
| MSDS | Chinese USA | Flash Point | 221.4±30.2 °C | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
Use of resveratrol triacetateTriacetylresveratrol, an acetylated analog of Resveratrol. Triacetylresveratrol decreases the phosphorylation of STAT3 and NF-κB in a dose- and time- dependent manner in PANC-1 and BxPC-3 cells. Anticancer effects[1]. |
| Name | Triacetylresveratrol |
|---|---|
| Synonym | More Synonyms |
| Description | Triacetylresveratrol, an acetylated analog of Resveratrol. Triacetylresveratrol decreases the phosphorylation of STAT3 and NF-κB in a dose- and time- dependent manner in PANC-1 and BxPC-3 cells. Anticancer effects[1]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB STAT3 |
| In Vitro | Triacetylresveratrol significantly down-regulates anti-apoptotic Bcl-2 family protein Mcl-1 and up-regulates pro-apoptotic Bcl-2 family proteins Bim and Puma. Triacetylresveratrol inhibits cell viability, and induces apoptosis of pancreatic cancer cells in a concentration and incubation time-dependent manner[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 504.8±50.0 °C at 760 mmHg |
| Melting Point | 117.0 to 121.0 °C |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.353 |
| Flash Point | 221.4±30.2 °C |
| Exact Mass | 354.110352 |
| PSA | 78.90000 |
| LogP | 2.94 |
| Appearance of Characters | white to tan |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | PDAYUJSOJIMKIS-SNAWJCMRSA-N |
| SMILES | CC(=O)Oc1ccc(C=Cc2cc(OC(C)=O)cc(OC(C)=O)c2)cc1 |
| Storage condition | room temp |
| Water Solubility | DMSO: ≥18mg/mL |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H315-H317-H318-H335-H400 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Hazard Codes | Xi,N |
| Risk Phrases | 37/38-41-43-50/53 |
| Safety Phrases | 26-36/37/39-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Benzenediol, 5-[(E)-2-[4-(acetyloxy)phenyl]ethenyl]-, diacetate |
| 3-Acetoxy-5-[(E)-2-(4-acetoxyphenyl)vinyl]phenyl acetate |
| 5-[(1E)-2-[4-(acetyloxy)phenyl]ethenyl]-1,3-Benzenediol-1,3-diacetate |
| Acetyl trans-resveratrol |
| (E)-5-(4-Acetoxystyryl)-1,3-phenylene diacetate |
| Triacetyl resveratrol |
| 3,4',5-Triacetoxy-trans-stilbene |
| Acetyl-trans-resveratrol |
| Acetic acid 4-[2-(3,5-diacetoxyphenyl)vinyl]phenyl ester |
| resveratrol triacetate |
| Acetyl-resveratrol |