1-C-(indol-3-yl)glycerol 3-phosphate structure
|
Common Name | 1-C-(indol-3-yl)glycerol 3-phosphate | ||
|---|---|---|---|---|
| CAS Number | 4220-97-7 | Molecular Weight | 287.20600 | |
| Density | 1.661g/cm3 | Boiling Point | 657.3ºC at 760 mmHg | |
| Molecular Formula | C11H14NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.3ºC | |
| Name | 1-C-(indol-3-yl)glycerol 3-phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.661g/cm3 |
|---|---|
| Boiling Point | 657.3ºC at 760 mmHg |
| Molecular Formula | C11H14NO6P |
| Molecular Weight | 287.20600 |
| Flash Point | 351.3ºC |
| Exact Mass | 287.05600 |
| PSA | 132.82000 |
| LogP | 0.67150 |
| Index of Refraction | 1.708 |
| InChIKey | NQEQTYPJSIEPHW-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)OCC(O)C(O)c1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
1-C-(indol-3-yl... CAS#:4220-97-7 |
| Literature: Yanofsky Biochimica et Biophysica Acta, 1956 , vol. 20, p. 438 Journal of Biological Chemistry, 1956 , vol. 223, p. 171 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indolglycerolphosphat |
| [2,3-dihydroxy-3-(1H-indol-3-yl)propyl] dihydrogen phosphate |
| IGPS |
| Indol-3-glycerol phosphat |
| Indole-3-glycerophosphate |