3-(indol-3-yl)propyl phosphate structure
|
Common Name | 3-(indol-3-yl)propyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 40716-80-1 | Molecular Weight | 255.20700 | |
| Density | 1.444g/cm3 | Boiling Point | 528.6ºC at 760 mmHg | |
| Molecular Formula | C11H14NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.5ºC | |
| Name | 3-(indol-3-yl)propyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 528.6ºC at 760 mmHg |
| Molecular Formula | C11H14NO4P |
| Molecular Weight | 255.20700 |
| Flash Point | 273.5ºC |
| Exact Mass | 255.06600 |
| PSA | 92.36000 |
| LogP | 2.20980 |
| Index of Refraction | 1.649 |
| InChIKey | NKEZSFZOUIIZFL-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)OCCCc1c[nH]c2ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(Indol-3-yl)propanol 3-phosphate |
| 3-(1H-indol-3-yl)propyl dihydrogen phosphate |
| Indolepropanol phosphate |
| 1h-indole-3-propanol,dihydrogen phosphate(ester) |
| indole-3-propanol phosphate |