2-[(4-chlorophenyl)methylideneamino]benzoic acid structure
|
Common Name | 2-[(4-chlorophenyl)methylideneamino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 42027-43-0 | Molecular Weight | 259.68800 | |
| Density | 1.23g/cm3 | Boiling Point | 462.4ºC at 760 mmHg | |
| Molecular Formula | C14H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 2-[(4-chlorophenyl)methylideneamino]benzoic acid |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 462.4ºC at 760 mmHg |
| Molecular Formula | C14H10ClNO2 |
| Molecular Weight | 259.68800 |
| Flash Point | 233.4ºC |
| Exact Mass | 259.04000 |
| PSA | 49.66000 |
| LogP | 3.78880 |
| Index of Refraction | 1.596 |
| InChIKey | HUALPDCOTZUBOD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1N=Cc1ccc(Cl)cc1 |
|
~60%
2-[(4-chlorophe... CAS#:42027-43-0 |
| Literature: Kumar, Ashok; Bansal, Deepti; Bajaj, Kiran; Sharma, Shalabh; Archana; Srivastava Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 23 p. 5281 - 5291 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |