2-(4-benzoylphenoxy)-N-cyclohexylacetamide
Modify Date: 2025-08-22 20:01:27
2-(4-benzoylphenoxy)-N-cyclohexylacetamide structure
|
Common Name | 2-(4-benzoylphenoxy)-N-cyclohexylacetamide | ||
|---|---|---|---|---|
| CAS Number | 42018-55-3 | Molecular Weight | 337.41200 | |
| Density | 1.17g/cm3 | Boiling Point | 572.5ºC at 760 mmHg | |
| Molecular Formula | C21H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300ºC | |
| Name | 2-(4-benzoylphenoxy)-N-cyclohexylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 572.5ºC at 760 mmHg |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.41200 |
| Flash Point | 300ºC |
| Exact Mass | 337.16800 |
| PSA | 58.89000 |
| LogP | 4.58560 |
| Index of Refraction | 1.59 |
| InChIKey | OZASRIDZANFMKE-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)NC1CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Cyclohexylcarbamoylmethoxybenzophenone |
| HMS2541C11 |