2-(4-acetylphenoxy)-N-cyclohexylacetamide structure
|
Common Name | 2-(4-acetylphenoxy)-N-cyclohexylacetamide | ||
|---|---|---|---|---|
| CAS Number | 42018-28-0 | Molecular Weight | 275.34300 | |
| Density | 1.13g/cm3 | Boiling Point | 511.3ºC at 760 mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263ºC | |
| Name | 2-(4-acetylphenoxy)-N-cyclohexylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 511.3ºC at 760 mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.34300 |
| Flash Point | 263ºC |
| Exact Mass | 275.15200 |
| PSA | 58.89000 |
| LogP | 3.55720 |
| Index of Refraction | 1.542 |
| InChIKey | ODJQAYIYMQYECH-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCC(=O)NC2CCCCC2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Cyclohexylcarbamoylmethoxyacetophenone |
| LS-7989 |