4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-ethyl-9-oxa-2,4,7-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one structure
|
Common Name | 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-ethyl-9-oxa-2,4,7-triazabicyclo[4.3.0]nona-2,7,10-trien-5-one | ||
|---|---|---|---|---|
| CAS Number | 42014-94-8 | Molecular Weight | 297.26400 | |
| Density | 1.83g/cm3 | Boiling Point | 588.6ºC at 760 mmHg | |
| Molecular Formula | C12H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.8ºC | |
| Name | 2-Ethyl-6-vinylpyrazin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.83g/cm3 |
|---|---|
| Boiling Point | 588.6ºC at 760 mmHg |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.26400 |
| Flash Point | 309.8ºC |
| Exact Mass | 297.09600 |
| PSA | 130.84000 |
| Index of Refraction | 1.755 |
| InChIKey | BNARASWPPGFPGD-UHFFFAOYSA-N |
| SMILES | CCc1nc2c(=O)n(C3OC(CO)C(O)C3O)cnc2o1 |
|
~%
4-[3,4-dihydrox... CAS#:42014-94-8 |
| Literature: Patil; Wise; Townsend; Bloch Journal of Medicinal Chemistry, 1974 , vol. 17, # 12 p. 1282 - 1285 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-ethyl-2-vinylpyrazine |
| 2-ETHYL-6-VINYLPYRAZINE |
| pyrazine,2-Ethyl,6-vinyl |