SW155246 structure
|
Common Name | SW155246 | ||
|---|---|---|---|---|
| CAS Number | 420092-79-1 | Molecular Weight | 378.787 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 613.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C16H11ClN2O5S | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 324.6±34.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of SW155246SW155246 is a DNA methyltransferase (DNMT1) selective inhibitor with IC50s of 1.2 and 38 μM for hDNMT1 and mDNMT3A, respectively. SW155246 can be used for the research of cancer and other diseases[1]. |
| Name | 4-Chloro-N-(4-hydroxy-1-naphthyl)-3-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | SW155246 is a DNA methyltransferase (DNMT1) selective inhibitor with IC50s of 1.2 and 38 μM for hDNMT1 and mDNMT3A, respectively. SW155246 can be used for the research of cancer and other diseases[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 613.2±65.0 °C at 760 mmHg |
| Molecular Formula | C16H11ClN2O5S |
| Molecular Weight | 378.787 |
| Flash Point | 324.6±34.3 °C |
| Exact Mass | 378.007721 |
| LogP | 3.94 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | JDYDEJYIVZNWQU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ccc(O)c3ccccc23)ccc1Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| 4-Chloro-N-(4-hydroxy-1-naphthyl)-3-nitrobenzenesulfonamide |
| Benzenesulfonamide, 4-chloro-N-(4-hydroxy-1-naphthalenyl)-3-nitro- |
| MFCD01165393 |
| SW155246 |