[3-benzoyloxy-2,2-bis(benzoyloxymethyl)propyl] benzoate structure
|
Common Name | [3-benzoyloxy-2,2-bis(benzoyloxymethyl)propyl] benzoate | ||
|---|---|---|---|---|
| CAS Number | 4196-86-5 | Molecular Weight | 552.57100 | |
| Density | 1.255g/cm3 | Boiling Point | 684.3ºC at 760 mmHg | |
| Molecular Formula | C33H28O8 | Melting Point | 102-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 286.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Pentaerythritol Tetrabenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 684.3ºC at 760 mmHg |
| Melting Point | 102-104 °C(lit.) |
| Molecular Formula | C33H28O8 |
| Molecular Weight | 552.57100 |
| Flash Point | 286.2ºC |
| Exact Mass | 552.17800 |
| PSA | 105.20000 |
| LogP | 5.40080 |
| Index of Refraction | 1.599 |
| InChIKey | MINJAOUGXYRTEI-UHFFFAOYSA-N |
| SMILES | O=C(OCC(COC(=O)c1ccccc1)(COC(=O)c1ccccc1)COC(=O)c1ccccc1)c1ccccc1 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
[3-benzoyloxy-2... CAS#:4196-86-5 |
| Literature: Rave; Tollens Justus Liebigs Annalen der Chemie, 1893 , vol. 276, p. 61 |
|
~%
[3-benzoyloxy-2... CAS#:4196-86-5 |
| Literature: Orthner; Freyss Justus Liebigs Annalen der Chemie, 1930 , vol. 484, p. 131,147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Structure of pentaerythritol tetrabenzoate. Bormann LM, et al.
Acta Crystallogr. C Struct. Chem. 49(11) , 1982-85, (1993)
|
|
|
Quantitative analysis of C 10-C 12 naphthalene hydrocarbons using gas chromatography and molecular spectroscopy. Vaisberg KM, et al.
Chem. Tech. Fuels Oils 1(9) , 736-40, (1965)
|
| MFCD00020676 |
| EINECS 224-079-8 |
| [3-benzoyloxy-2,2-bis(benzoyloxymethyl)propyl] benzoate |