tris(4-iodophenyl)amine structure
|
Common Name | tris(4-iodophenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 4181-20-8 | Molecular Weight | 623.008 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 559.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H12I3N | Melting Point | 167 °C | |
| MSDS | N/A | Flash Point | 292.2±28.7 °C | |
| Name | Tris(4-iodophenyl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.5±45.0 °C at 760 mmHg |
| Melting Point | 167 °C |
| Molecular Formula | C18H12I3N |
| Molecular Weight | 623.008 |
| Flash Point | 292.2±28.7 °C |
| Exact Mass | 622.810364 |
| PSA | 3.24000 |
| LogP | 9.56 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.767 |
| InChIKey | AQGZDWJFOYXGAA-UHFFFAOYSA-N |
| SMILES | Ic1ccc(N(c2ccc(I)cc2)c2ccc(I)cc2)cc1 |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2921499090 |
|
~10%
tris(4-iodophen... CAS#:4181-20-8 |
| Literature: KABUSHIKI KAISHA TOYOTA CHUO KENKYUSHO; TOYOSHI SHIMADA Patent: US2009/54649 A1, 2009 ; Location in patent: Page/Page column 43-44 ; |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Tris(4-iodophenyl)aMine |
| tri(4-iodophenyl)amine |
| Tris-(4-Iodophenyl)Amine |
| Benzenamine, 4-iodo-N,N-bis(4-iodophenyl)- |
| Tris-(4-iodo-phenyl)-amine |
| 4-Iodo-N,N-bis(4-iodophenyl)aniline |
| MFCD01321198 |