4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid
Modify Date: 2025-09-11 18:09:44
4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid structure
|
Common Name | 4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 41725-30-8 | Molecular Weight | 332.22200 | |
| Density | 1.632g/cm3 | Boiling Point | 566.6ºC at 760 mmHg | |
| Molecular Formula | C14H8N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | 4-(4-carboxy-2-nitrophenyl)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.632g/cm3 |
|---|---|
| Boiling Point | 566.6ºC at 760 mmHg |
| Molecular Formula | C14H8N2O8 |
| Molecular Weight | 332.22200 |
| Flash Point | 236.7ºC |
| Exact Mass | 332.02800 |
| PSA | 166.24000 |
| LogP | 3.61280 |
| Index of Refraction | 1.69 |
| InChIKey | HRGSKQRXBGCEAZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=O)O)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
|
~%
4-(4-carboxy-2-... CAS#:41725-30-8 |
| Literature: Bell; Robinson Journal of the Chemical Society, 1927 , p. 2238 |
|
~%
4-(4-carboxy-2-... CAS#:41725-30-8 |
| Literature: Wu, Rui Feng; Zhang, Tong Lai; Qiao, Xiao Jing Chinese Chemical Letters, 2010 , vol. 21, # 8 p. 1007 - 1010 |
|
~%
4-(4-carboxy-2-... CAS#:41725-30-8 |
| Literature: v. Jakubowski; v. Niementowski Chemische Berichte, 1909 , vol. 42, p. 648 |
| 2,2'-dinitrobiphenyl-4,4'-dicarboxylic acid |
| 2,2'-dinitro-4,4'-biphenyldicarboxylic acid |
| 2,2'-dinitro-[1,1'-biphenyl]-4,4'-dicarboxylic acid |
| [1,1'-Biphenyl]-4,4'-dicarboxylicacid,2,2'-dinitro |
| 2,2'-Dinitro-biphenyl-4,4'-dicarbonsaeure,Brucin-Salz |