2-(3-Nitrophenylsulfonyl)ethanol
Modify Date: 2025-08-25 13:13:23
2-(3-Nitrophenylsulfonyl)ethanol structure
|
Common Name | 2-(3-Nitrophenylsulfonyl)ethanol | ||
|---|---|---|---|---|
| CAS Number | 41687-30-3 | Molecular Weight | 231.22600 | |
| Density | 1.472g/cm3 | Boiling Point | 475.4ºC at 760mmHg | |
| Molecular Formula | C8H9NO5S | Melting Point | 76-78ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 241.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(3-nitrophenyl)sulfonylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760mmHg |
| Melting Point | 76-78ºC(lit.) |
| Molecular Formula | C8H9NO5S |
| Molecular Weight | 231.22600 |
| Flash Point | 241.3ºC |
| Exact Mass | 231.02000 |
| PSA | 108.57000 |
| LogP | 1.96480 |
| Index of Refraction | 1.581 |
| InChIKey | VMORQDKKMBAQPJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)CCO)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2906299090 |
|
~30%
2-(3-Nitropheny... CAS#:41687-30-3 |
| Literature: Boehringer Ingelheim Pharma GmbH and Co. KG Patent: EP1953163 A1, 2008 ; Location in patent: Page/Page column 17 ; EP 1953163 A1 |
|
~%
2-(3-Nitropheny... CAS#:41687-30-3 |
| Literature: Samukov, V. V.; Sabirov, A. N.; Troshkov, M. L. J. Gen. Chem. USSR (Engl. Transl.), 1988 , vol. 58, # 6 p. 1432 - 1439,1277 - 1283 |
|
~%
2-(3-Nitropheny... CAS#:41687-30-3 |
| Literature: Limpricht Justus Liebigs Annalen der Chemie, 1897 , vol. 294, p. 248 |
![1-nitro-3-[2-(3-nitrophenyl)sulfonylethylsulfonyl]benzene structure](https://image.chemsrc.com/caspic/353/870479-85-9.png)
![2-[(3-Aminophenyl)sulfonyl]ethanol structure](https://image.chemsrc.com/caspic/280/5246-57-1.png)
CAS#:5246-57-1
CAS#:651728-08-4| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-(3-Nitro-benzolsulfonyl)-aethanol |
| 2-(3-Nitrophenylsulfonyl)ethanol |
| 2-(3-nitrobenzenesulfonyl)ethanol |
| AC1L55T2 |
| EINECS 255-501-9 |
| CTK4I5118 |
| 3-[(2-hydroxyethyl)sulfonyl]-nitrobenzene |
| ACMC-20aoq5 |
| MFCD00134178 |