Tetrabromobisphenol A Bis(2-hydroxyethyl) Ether structure
|
Common Name | Tetrabromobisphenol A Bis(2-hydroxyethyl) Ether | ||
|---|---|---|---|---|
| CAS Number | 4162-45-2 | Molecular Weight | 631.976 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 582.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H20Br4O4 | Melting Point | 107 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 305.8±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,4'-Isopropylidenebis[2-(2,6-dibromophenoxy)ethanol] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 582.1±50.0 °C at 760 mmHg |
| Melting Point | 107 °C(lit.) |
| Molecular Formula | C19H20Br4O4 |
| Molecular Weight | 631.976 |
| Flash Point | 305.8±30.1 °C |
| Exact Mass | 627.809509 |
| PSA | 58.92000 |
| LogP | 4.98 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | RVHUMFJSCJBNGS-UHFFFAOYSA-N |
| SMILES | CC(C)(c1cc(Br)c(OCCO)c(Br)c1)c1cc(Br)c(OCCO)c(Br)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 3152 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 9 |
| HS Code | 2909499000 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Ethanol, 2,2'-[(1-methylethylidene)bis[(2,6-dibromo-4,1-phenylene)oxy]]bis- |
| 2,2-Bis(3,5-dibromo-4-(2-hydroxyethoxy)phenyl)propane |
| 2,2'-{propane-2,2-diylbis[(2,6-dibromobenzene-4,1-diyl)oxy]}diethanol |
| 2,2'-{2,2-Propanediylbis[(2,6-dibromo-4,1-phenylene)oxy]}diethanol |
| MFCD00059603 |
| Ethanol, 2,2'-((1-methylethylidene)bis((2,6-dibromo-4,1-phenylene)oxy))bis- |
| Fire Guard 3600 |
| EINECS 224-005-4 |
| AFR 1011 |
| 2,2-bis[4-(2-hydroxyethoxy)-3,5-dibromophenyl]propane |
| O,O-BIS(2-HYDROXYETHYL)TETRABROMOBISPHENOL A |
| tetrabromobisphenol-a-bisethoxylate. |
| 2,2'-{Propane-2,2-diylbis[(2,6-dibromo-4,1-phenylene)oxy]}diethanol |
| 2,2-Bis[3,5-dibromo-4-(2-hydroxyethoxy)phenyl]propane |
| Tetrabromobisphenol A Bis(2-hydroxyethyl) Ether |
| Tetrabromobisphenol A bis(hydroxyethyl ether) |
| BA 50 |
| 2,2-bis[3,5-dibromo-4-(2-hydroxyethoxy)phenyl] propane |
| ETHOXYLATEDTETRABROMOBISPHENOLA |
| BIS(2-HYDROXYETHYLETHER)TETRABROMOBISPHENOLA |