GS-389
Modify Date: 2025-08-25 15:59:42
GS-389 structure
|
Common Name | GS-389 | ||
|---|---|---|---|---|
| CAS Number | 41498-37-7 | Molecular Weight | 313.39100 | |
| Density | 1.108g/cm3 | Boiling Point | 454ºC at 760 mmHg | |
| Molecular Formula | C19H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
Use of GS-389GS 389 ((±)-O,O-Dimethylcoclaurine) is a tetrahydroisoquinoline. GS-389 inhibites Cyclic AMP and cyclic AMP dependent phosphodiesterases from rat atrial and ventricular tissue. GS-389 relaxes the contraction induced by phenylephrine and high K+ in rat aortic rings[1]. |
| Name | 6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Description | GS 389 ((±)-O,O-Dimethylcoclaurine) is a tetrahydroisoquinoline. GS-389 inhibites Cyclic AMP and cyclic AMP dependent phosphodiesterases from rat atrial and ventricular tissue. GS-389 relaxes the contraction induced by phenylephrine and high K+ in rat aortic rings[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.108g/cm3 |
|---|---|
| Boiling Point | 454ºC at 760 mmHg |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.39100 |
| Flash Point | 191.6ºC |
| Exact Mass | 313.16800 |
| PSA | 39.72000 |
| LogP | 3.47070 |
| Index of Refraction | 1.557 |
| InChIKey | GXTUEUWFEKEQHJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1 |
| HS Code | 2933499090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:4078-65-3
CAS#:72527-29-8
CAS#:104-01-8
CAS#:120-20-7amine Structure](https://image.chemsrc.com/caspic/238/114105-51-0.png)
CAS#:114105-51-0![N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[1-((1S)-phenyl)ethyl]-2-(4-methoxyphenyl)acetamide Structure](https://image.chemsrc.com/caspic/437/1421820-27-0.png)
CAS#:1421820-27-0
CAS#:1798-09-0
CAS#:4693-91-8
CAS#:6834-42-0
CAS#:186581-53-3![Isoquinoline,1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]-2-methyl- structure](https://image.chemsrc.com/caspic/135/1934-93-6.png)
CAS#:1934-93-6| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| coclaurine dimethyl ether |
| 1,2,3,4-tetrahydro-6,7-dimethoxy-1-[(4-methoxyphenyl)methyl]isoquinoline |
| 7,12-O,O'-dimethylcoclaurine |
| N-(3,4-dimethoxyphenylethyl)-2-(3-methoxyphenyl)acetamide |
| 6,7-dimethoxy-1-(4-methoxy-benzyl)-1,2,3,4-tetrahydroisoquinoline |
| rac-O,O-dimethylcoclaurine |
| GS-389 |
| (+/-)-1-(4-methoxybenzyl)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline |