allyldiphenylphosphine oxide structure
|
Common Name | allyldiphenylphosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 4141-48-4 | Molecular Weight | 242.25300 | |
| Density | 1.09g/cm3 | Boiling Point | 337ºC at 760mmHg | |
| Molecular Formula | C15H15OP | Melting Point | 110-114ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 157.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [phenyl(prop-2-enyl)phosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 337ºC at 760mmHg |
| Melting Point | 110-114ºC(lit.) |
| Molecular Formula | C15H15OP |
| Molecular Weight | 242.25300 |
| Flash Point | 157.6ºC |
| Exact Mass | 242.08600 |
| PSA | 26.88000 |
| LogP | 3.18650 |
| Index of Refraction | 1.564 |
| InChIKey | PGPAPANRSWMTQO-UHFFFAOYSA-N |
| SMILES | C=CCP(=O)(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2902909090 |
| HS Code | 2902909090 |
|---|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| Allyldiphenylphosphine oxide |
| allyldiphenylphosphane oxide |
| diphenyl allyl phosphine oxide |
| MFCD00013908 |