1-Amino-3-(4-tert-butyl-phenoxy)-propan-2-ol
Modify Date: 2025-08-27 00:28:33
1-Amino-3-(4-tert-butyl-phenoxy)-propan-2-ol structure
|
Common Name | 1-Amino-3-(4-tert-butyl-phenoxy)-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 41403-84-3 | Molecular Weight | 223.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Amino-3-(4-tert-butyl-phenoxy)-propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H21NO2 |
|---|---|
| Molecular Weight | 223.31100 |
| Exact Mass | 223.15700 |
| PSA | 55.48000 |
| LogP | 2.38280 |
| InChIKey | LPNCSYWIVAILJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OCC(O)CN)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-amino-3-(4-tert-butylphenoxy)propan-2-ol |