3-[(2,2-dimethyl-3-oxo-propyl)-methyl-amino]-2,2-dimethyl-propanal structure
|
Common Name | 3-[(2,2-dimethyl-3-oxo-propyl)-methyl-amino]-2,2-dimethyl-propanal | ||
|---|---|---|---|---|
| CAS Number | 41348-50-9 | Molecular Weight | 199.29000 | |
| Density | 0.939g/cm3 | Boiling Point | 266.4ºC at 760 mmHg | |
| Molecular Formula | C11H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.8ºC | |
| Name | 3-[(2,2-dimethyl-3-oxopropyl)-methylamino]-2,2-dimethylpropanal |
|---|---|
| Synonym | More Synonyms |
| Density | 0.939g/cm3 |
|---|---|
| Boiling Point | 266.4ºC at 760 mmHg |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29000 |
| Flash Point | 92.8ºC |
| Exact Mass | 199.15700 |
| PSA | 37.38000 |
| LogP | 1.36840 |
| Index of Refraction | 1.45 |
| InChIKey | XJQPEZWAYFWSGG-UHFFFAOYSA-N |
| SMILES | CN(CC(C)(C)C=O)CC(C)(C)C=O |
|
~%
3-[(2,2-dimethy... CAS#:41348-50-9 |
| Literature: Johnson,P.Y. et al. Journal of Organic Chemistry, 1973 , vol. 38, # 21 p. 3753 - 3757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3'-(methylimino)bis(2,2-dimethylpropanal) |