2-phenylethynyl-tri(propan-2-yl)silane
Modify Date: 2025-09-24 17:30:20
2-phenylethynyl-tri(propan-2-yl)silane structure
|
Common Name | 2-phenylethynyl-tri(propan-2-yl)silane | ||
|---|---|---|---|---|
| CAS Number | 4131-50-4 | Molecular Weight | 258.47400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylethynyl-tri(propan-2-yl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H26Si |
|---|---|
| Molecular Weight | 258.47400 |
| Exact Mass | 258.18000 |
| LogP | 5.25610 |
| InChIKey | IZLRZCVZUWQQMW-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C#Cc1ccccc1)(C(C)C)C(C)C |
| HS Code | 2931900090 |
|---|
![tri(propan-2-yl)-[4-tri(propan-2-yl)silylbuta-1,3-diynyl]silane structure](https://image.chemsrc.com/caspic/081/125251-42-5.png)
CAS#:886-66-8| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [2-[tris(1-methylethyl)silyl]ethynyl]benzene |
| Phenylaethinyl-triisopropyl-silan |
| triisopropylsilylethynyl-benzene |
| tris(1-methylethyl)(phenylethynyl)silane |
| phenyl(triisopropylsilyl)acetylene |
| Silane,tris(1-methylethyl)(phenylethynyl) |
| triisopropyl(phenylethynyl)silane |