7-Quinolinamine,1,2-dihydro-2,2,4-trimethyl- structure
|
Common Name | 7-Quinolinamine,1,2-dihydro-2,2,4-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 41148-72-5 | Molecular Weight | 188.26900 | |
| Density | 1.021g/cm3 | Boiling Point | 327.7ºC at 760mmHg | |
| Molecular Formula | C12H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | 2,2,4-trimethyl-1H-quinolin-7-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.021g/cm3 |
|---|---|
| Boiling Point | 327.7ºC at 760mmHg |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.26900 |
| Flash Point | 177.9ºC |
| Exact Mass | 188.13100 |
| PSA | 38.05000 |
| LogP | 3.59540 |
| Index of Refraction | 1.56 |
| InChIKey | MQTNSXZENRCZIY-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)Nc2cc(N)ccc21 |
| HS Code | 2933499090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2,4-trimethyl-1,2-dihydro-quinolin-7-ylamine |
| 7-amino-1,2-dihydro-2,2,4-trimethylquinoline |
| 2,2,4-trimethyl-1,2-dihydroquinolin-7-amine |