Methyl (-)-Shikimate structure
|
Common Name | Methyl (-)-Shikimate | ||
|---|---|---|---|---|
| CAS Number | 40983-58-2 | Molecular Weight | 188.17800 | |
| Density | 1.489g/cm3 | Boiling Point | 317.3ºC at 760 mmHg | |
| Molecular Formula | C8H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.7ºC | |
| Name | methyl 3,4,5-trihydroxycyclohexene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.489g/cm3 |
|---|---|
| Boiling Point | 317.3ºC at 760 mmHg |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.17800 |
| Flash Point | 127.7ºC |
| Exact Mass | 188.06800 |
| PSA | 86.99000 |
| Index of Refraction | 1.596 |
| InChIKey | LSNUUAUXWJZSFD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(O)C(O)C(O)C1 |
| HS Code | 2918199090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| methyl (3R,4S,5R)-3,4,5-trihydroxy-1-cyclohexenecarboxylate |
| methyl (3R)-(-)-3-hydroxypentanoate |
| Pentanoic acid,3-hydroxy-,methyl ester |
| (R)-(-)-methyl 3-hydroxypentanoate |
| (-)-shikimic acid methyl ester |
| (-)-(3R)-methyl 3-hydroxypentanoate |
| (S)-Methyl3-Hydroxypentanoate |
| Methyl (-)-Shikimate |
| methyl (3R,4S,5R)-3,4,5-trihydroxy-1-cyclohexene-1-carboxylate |
| methyl (R)-3-hydroxypentanoate |
| methyl D-(R)-3-hydroxypentanoate |
| methyl (3R)-hydroxypentanoate |
| methyl (3R,4S,5R)-shikimate |
| D-(-)-methyl-2-hydroxybutanoate |
| methyl <7-12C>shikimate |
| (3R,4S,5R)-3,4,5-trihydroxycyclohex-1-ene-1-carboxylic acid methyl ester |