2,6-dinitro-4-octylphenol
Modify Date: 2025-11-25 21:46:52
2,6-dinitro-4-octylphenol structure
|
Common Name | 2,6-dinitro-4-octylphenol | ||
|---|---|---|---|---|
| CAS Number | 4097-33-0 | Molecular Weight | 296.31900 | |
| Density | 1.217g/cm3 | Boiling Point | 385ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9ºC | |
| Name | 2,6-dinitro-4-octylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 385ºC at 760 mmHg |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.31900 |
| Flash Point | 152.9ºC |
| Exact Mass | 296.13700 |
| PSA | 111.87000 |
| LogP | 5.15800 |
| Index of Refraction | 1.558 |
| InChIKey | NYGISSDEOKKXOE-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| HS Code | 2908999090 |
|---|
|
~%
2,6-dinitro-4-o... CAS#:4097-33-0 |
| Literature: Dutton et al. Canadian Journal of Chemistry, 1953 , vol. 31, p. 837,839 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Phenol,2,6-dinitro-4-octyl |
| 2,6-dinitro-4-octyl-phenol |