2-hydroxy-5-(2-methylbutan-2-yl)benzoic acid structure
|
Common Name | 2-hydroxy-5-(2-methylbutan-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 40946-44-9 | Molecular Weight | 208.25400 | |
| Density | 1.134g/cm3 | Boiling Point | 338.3ºC at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | 2-hydroxy-5-(2-methylbutan-2-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 338.3ºC at 760 mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 172.6ºC |
| Exact Mass | 208.11000 |
| PSA | 57.53000 |
| LogP | 2.77800 |
| Index of Refraction | 1.545 |
| InChIKey | JAWMDQPKGUFLQE-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(O)c(C(=O)O)c1 |
|
~%
2-hydroxy-5-(2-... CAS#:40946-44-9 |
| Literature: Sen; Sen Gupta Journal of the Indian Chemical Society, 1955 , vol. 32, p. 619 |
|
~%
2-hydroxy-5-(2-... CAS#:40946-44-9 |
| Literature: Sen; Sen Gupta Journal of the Indian Chemical Society, 1955 , vol. 32, p. 619 |
|
~%
2-hydroxy-5-(2-... CAS#:40946-44-9 |
| Literature: Resinous Prod. and Chem. Co. Patent: US1998750 , 1931 ; |
| 2-Hydroxy-5-tert-pentyl-benzoesaeure |
| 5-tert.-Pentylsalicylsaeure |
| 2-hydroxy-5-tert-pentyl-benzoic acid |