2-(4-methylphenyl)sulfonylnaphthalene-1,4-dione
Modify Date: 2025-10-08 17:47:13
2-(4-methylphenyl)sulfonylnaphthalene-1,4-dione structure
|
Common Name | 2-(4-methylphenyl)sulfonylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 40852-77-5 | Molecular Weight | 312.34000 | |
| Density | 1.393g/cm3 | Boiling Point | 525.4ºC at 760 mmHg | |
| Molecular Formula | C17H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.8ºC | |
| Name | 2-(4-methylphenyl)sulfonylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 525.4ºC at 760 mmHg |
| Molecular Formula | C17H12O4S |
| Molecular Weight | 312.34000 |
| Flash Point | 342.8ºC |
| Exact Mass | 312.04600 |
| PSA | 76.66000 |
| LogP | 3.81260 |
| Index of Refraction | 1.645 |
| InChIKey | UCFUGRHGHVYUOA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C2=CC(=O)c3ccccc3C2=O)cc1 |
|
~%
2-(4-methylphen... CAS#:40852-77-5 |
| Literature: Kvalnes Journal of the American Chemical Society, 1934 , vol. 56, p. 670 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-tosylnaphthalene-1,4-dione |