2-amino-3-(4-methylphenyl)sulfonylnaphthalene-1,4-dione structure
|
Common Name | 2-amino-3-(4-methylphenyl)sulfonylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 93325-61-2 | Molecular Weight | 327.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-3-(4-methylphenyl)sulfonylnaphthalene-1,4-dione |
|---|
| Molecular Formula | C17H13NO4S |
|---|---|
| Molecular Weight | 327.35400 |
| Exact Mass | 327.05700 |
| PSA | 102.68000 |
| LogP | 3.79930 |
| InChIKey | RIHQTIZATGSPDA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(N)C(=O)c3ccccc3C2=O)cc1 |
|
~%
2-amino-3-(4-me... CAS#:93325-61-2 |
| Literature: Bradley,W.; Hannon,J.D. Journal of the Chemical Society, 1962 , p. 2713 - 2719 |
|
~%
2-amino-3-(4-me... CAS#:93325-61-2 |
| Literature: Bradley,W.; Hannon,J.D. Journal of the Chemical Society, 1962 , p. 2713 - 2719 |