1-Chloro-4-(4-methoxyphenoxy)benzene structure
|
Common Name | 1-Chloro-4-(4-methoxyphenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 40843-46-7 | Molecular Weight | 234.67800 | |
| Density | 1.198g/cm3 | Boiling Point | 325.174ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.603ºC | |
| Name | 1-Chloro-4-(4-methoxyphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.198g/cm3 |
|---|---|
| Boiling Point | 325.174ºC at 760 mmHg |
| Molecular Formula | C13H11ClO2 |
| Molecular Weight | 234.67800 |
| Flash Point | 121.603ºC |
| Exact Mass | 234.04500 |
| PSA | 18.46000 |
| LogP | 4.14090 |
| Index of Refraction | 1.57 |
| InChIKey | LDSWCHHBUKZOCS-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(Cl)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1-chloro-4-(4-methoxyphenoxy) |
| 4-chloro-4'-methoxy-diphenyl ether |
| 4-(4-Chlorophenoxy)anisole |
| 1-(4-chlorophenoxy)-4-methoxybenzene |
| 4-(4-Chlorophenoxy)methoxybenzene |
| 1-(4-Chlor-phenoxy)-4-methoxy-benzol |
| 4-chlorophenyl 4-methoxyphenyl ether |