N-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethylethanamine structure
|
Common Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 40828-00-0 | Molecular Weight | 248.40700 | |
| Density | 0.924g/cm3 | Boiling Point | 308.1ºC at 760 mmHg | |
| Molecular Formula | C16H28N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.8ºC | |
| Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.924g/cm3 |
|---|---|
| Boiling Point | 308.1ºC at 760 mmHg |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.40700 |
| Flash Point | 126.8ºC |
| Exact Mass | 248.22500 |
| PSA | 6.48000 |
| LogP | 3.37020 |
| Index of Refraction | 1.511 |
| InChIKey | AALVUMWHVZETDU-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cc1ccc(CN(CC)CC)cc1 |
| HS Code | 2921499090 |
|---|
|
~%
N-[[4-(diethyla... CAS#:40828-00-0 |
| Literature: Fusco et al. Gazzetta Chimica Italiana, 1948 , vol. 78, p. 951,961 |
|
~%
N-[[4-(diethyla... CAS#:40828-00-0 |
| Literature: Fusco et al. Gazzetta Chimica Italiana, 1948 , vol. 78, p. 951,961 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1,4-Benzenedimethanamine,N,N,N',N'-tetraethyl |
| 1,4-Benzenedimethanamine,N1,N1,N4,N4-tetraethyl |
| 1,4-Bis-diaethylaminomethyl-benzol |
| Tetra-N-aethyl-p-xylylendiamin |
| tetra-N-ethyl-p-xylylenediamine |