(5-nitrofuran-2-yl)methyl nitrate
Modify Date: 2025-08-25 13:14:02
(5-nitrofuran-2-yl)methyl nitrate structure
|
Common Name | (5-nitrofuran-2-yl)methyl nitrate | ||
|---|---|---|---|---|
| CAS Number | 4077-62-7 | Molecular Weight | 188.09500 | |
| Density | 1.573g/cm3 | Boiling Point | 330.9ºC at 760 mmHg | |
| Molecular Formula | C5H4N2O6 | Melting Point | 36-39ºC(lit.) | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (5-nitrofuran-2-yl)methyl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 330.9ºC at 760 mmHg |
| Melting Point | 36-39ºC(lit.) |
| Molecular Formula | C5H4N2O6 |
| Molecular Weight | 188.09500 |
| Flash Point | >230 °F |
| Exact Mass | 188.00700 |
| PSA | 114.01000 |
| LogP | 1.94250 |
| Index of Refraction | 1.544 |
| InChIKey | IZUDEUAXDJRXOA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])OCc1ccc([N+](=O)[O-])o1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932190090 |
|
~%
(5-nitrofuran-2... CAS#:4077-62-7 |
| Literature: Howard; Klein Journal of Organic Chemistry, 1959 , vol. 24, p. 255 |
CAS#:698-63-5
CAS#:2493-04-1
CAS#:823-74-5
CAS#:4610-65-5| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Inducible stable DNA replication in Escherichia coli uvr+ and uvr- cells, treated with genotoxic chemicals.
Mutat. Res. 281(1) , 63-6, (1992) Inducible stable DNA replication (iSDR) provoked by a damaging treatment with MMS, MNU, MNNG, NFAA, NFN, 4NQO, NAL or MMC, was followed in both repair-competent E. coli PQ35 and its uvrA derivative E.... |
| 5-Nitro-furfurylnitrat |
| 5-Nitro-2-furfuryl-nitrat |
| MFCD03093916 |
| 2-Nitro-5-nitryloxymethyl-furan |
| 5-nitrofurfuryl nitrate |
| 5-Nitro-2-furfurylnitrate |
| 2-nitro-5-nitryloximethyl-furan |
| 5-NFN |
| 2-nitro-5-nitrooxymethyl furan |