2-acenaphthen-1-ylpropanedioic acid
Modify Date: 2025-08-27 12:26:37
2-acenaphthen-1-ylpropanedioic acid structure
|
Common Name | 2-acenaphthen-1-ylpropanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 40745-37-7 | Molecular Weight | 256.25300 | |
| Density | 1.453g/cm3 | Boiling Point | 559ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.9ºC | |
| Name | 1-Acenaphthenemalonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 559ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 305.9ºC |
| Exact Mass | 256.07400 |
| PSA | 74.60000 |
| LogP | 2.26490 |
| Index of Refraction | 1.707 |
| InChIKey | YYWXGCHGKLJVAE-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(=O)O)C1Cc2cccc3cccc1c23 |
|
~%
2-acenaphthen-1... CAS#:40745-37-7 |
| Literature: Bachmann; Sheehan Journal of the American Chemical Society, 1941 , vol. 63, p. 204 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Amino-acenaphthen |
| 2-Amino-acenaphthen |
| Acenaphthyl-1-malonsaeure |
| acenaphthen-1-ylamine |
| Acenaphthen-1-ylamin |
| acenaphthen-1-ylamine,hydrochloride |
| acenaphthen-1-yl-malonic acid |
| Acenaphthen-1-ylamin,Hydrochlorid |
| 1-aminoacenaphthene |
| Acenaphthen-1-amine chloride |
| Acenaphthen-1-yl-malonsaeure |
| 1-Acenaphthenamine hydrochloride |