chapso structure
|
Common Name | chapso | ||
|---|---|---|---|---|
| CAS Number | 40427-75-6 | Molecular Weight | 292.36900 | |
| Density | 1.187 g/cm3 | Boiling Point | 454.11ºC at 760 mmHg | |
| Molecular Formula | C14H28O6 | Melting Point | 122-128 °C (lit.) | |
| MSDS | N/A | Flash Point | 228.437ºC | |
| Name | Octyl β-D-galactopyranoside |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187 g/cm3 |
|---|---|
| Boiling Point | 454.11ºC at 760 mmHg |
| Melting Point | 122-128 °C (lit.) |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.36900 |
| Flash Point | 228.437ºC |
| Exact Mass | 292.18900 |
| PSA | 99.38000 |
| LogP | 0.16340 |
| Index of Refraction | 1.516 |
| InChIKey | HEGSGKPQLMEBJL-MBJXGIAVSA-N |
| SMILES | CCCCCCCCOC1OC(CO)C(O)C(O)C1O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-OCTYL-β-D-GLUCOPYRANOSIDE |
| MFCD00063288 |
| EINECS 249-887-8 |