4,5-bis(4-methoxyphenyl)-1,3-dioxol-2-one
Modify Date: 2025-08-28 07:58:24
4,5-bis(4-methoxyphenyl)-1,3-dioxol-2-one structure
|
Common Name | 4,5-bis(4-methoxyphenyl)-1,3-dioxol-2-one | ||
|---|---|---|---|---|
| CAS Number | 40352-56-5 | Molecular Weight | 298.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-bis(4-methoxyphenyl)-1,3-dioxol-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H14O5 |
|---|---|
| Molecular Weight | 298.29000 |
| Exact Mass | 298.08400 |
| PSA | 61.81000 |
| LogP | 3.58400 |
| InChIKey | HMIKQDXHJPMYQM-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc(=O)oc2-c2ccc(OC)cc2)cc1 |
|
~66%
4,5-bis(4-metho... CAS#:40352-56-5 |
| Literature: Sahu, Devi Prasad Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 8 p. 1722 - 1723 |
|
~%
4,5-bis(4-metho... CAS#:40352-56-5 |
| Literature: Sahu, Devi Prasad Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 8 p. 1722 - 1723 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Di-(p-anisyl)vinylencarbonat |
| Di-(p-methoxyphenyl)vinylencarbonat |
| 4,5-bis-(4-methoxy-phenyl)-[1,3]dioxol-2-one |
| 1,3-Dioxol-2-one,4,5-bis(4-methoxyphenyl) |
| 4,5-Di-(p-methoxyphenyl)-1,3-dioxol-2-on |
| Di(p-methoxyphenyl)vinylencarboant |