Thalidomide-5-methyl
Modify Date: 2025-08-26 19:09:24
Thalidomide-5-methyl structure
|
Common Name | Thalidomide-5-methyl | ||
|---|---|---|---|---|
| CAS Number | 40313-92-6 | Molecular Weight | 272.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thalidomide-5-methylThalidomide-5-methyl is the Thalidomide-based cereblon (CRBN) ligand used in the recruitment of CRBN protein[1]. |
| Name | Thalidomide-5-methyl |
|---|
| Description | Thalidomide-5-methyl is the Thalidomide-based cereblon (CRBN) ligand used in the recruitment of CRBN protein[1]. |
|---|---|
| Related Catalog | |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H12N2O4 |
|---|---|
| Molecular Weight | 272.26 |
| InChIKey | FIRKPGPRAMCBHV-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |