1,4-Dimethoxy-2-(2-nitroethenyl) benzene structure
|
Common Name | 1,4-Dimethoxy-2-(2-nitroethenyl) benzene | ||
|---|---|---|---|---|
| CAS Number | 40276-11-7 | Molecular Weight | 209.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 350.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | 116-120ºC(lit.) | |
| MSDS | N/A | Flash Point | 163.2±25.7 °C | |
| Name | 2,5-Dimethoxy-β-nitrostyrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 350.8±27.0 °C at 760 mmHg |
| Melting Point | 116-120ºC(lit.) |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.199 |
| Flash Point | 163.2±25.7 °C |
| Exact Mass | 209.068802 |
| PSA | 64.28000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | IRRZIWHEPWPPJF-AATRIKPKSA-N |
| SMILES | COc1ccc(OC)c(C=C[N+](=O)[O-])c1 |
|
~%
1,4-Dimethoxy-2... CAS#:40276-11-7 |
| Literature: Solomonovici,A.; Blumberg,S. Tetrahedron, 1966 , vol. 22, p. 2505 - 2509 |
|
~%
1,4-Dimethoxy-2... CAS#:40276-11-7 |
| Literature: Kauffmann Chemische Berichte, 1917 , vol. 50, p. 635 Chemische Berichte, 1919 , vol. 52, p. 1431 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-Dimethoxy-2-[(E)-2-nitrovinyl]benzene |
| 1,4-Dimethoxy-2-[(E)-2-nitroethenyl]benzene |
| 1,4-Dimethoxy-2-(2-nitroethenyl) benzene |
| Benzene, 1,4-dimethoxy-2-[(E)-2-nitroethenyl]- |
| 2,5-DIMETHOXY-BETA-NITROSTYRENE |
| MFCD00065072 |