1-(2-methylbenzoyl)piperidine-4-carboxylic acid
Modify Date: 2025-09-12 15:56:10
1-(2-methylbenzoyl)piperidine-4-carboxylic acid structure
|
Common Name | 1-(2-methylbenzoyl)piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 401581-31-5 | Molecular Weight | 247.29000 | |
| Density | 1.217g/cm3 | Boiling Point | 460.6ºC at 760 mmHg | |
| Molecular Formula | C14H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.4ºC | |
| Name | 1-(2-methylbenzoyl)piperidine-4-carboxylic acid |
|---|
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 460.6ºC at 760 mmHg |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29000 |
| Flash Point | 232.4ºC |
| Exact Mass | 247.12100 |
| PSA | 57.61000 |
| LogP | 1.86970 |
| Index of Refraction | 1.576 |
| InChIKey | ZDLGPPDQCGOJTL-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)N1CCC(C(=O)O)CC1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |