Erucifoline structure
|
Common Name | Erucifoline | ||
|---|---|---|---|---|
| CAS Number | 40158-95-0 | Molecular Weight | 349.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ErucifolineErucifoline is a pyrrolizidine alkaloid that can be found in the aerial parts of Senecio aquaticus[1][2]. |
| Name | (E)-8-ethylidene-9a-(hydroxymethyl)-10a-methyl-2,31,4,5,5a,8,9,9a,10a,13-decahydrooxireno[2',3':8,9][1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-7,11-dione |
|---|
| Description | Erucifoline is a pyrrolizidine alkaloid that can be found in the aerial parts of Senecio aquaticus[1][2]. |
|---|---|
| Related Catalog | |
| References |
[1]. Christov VS, et, al. Alkaloids from Senecio aquaticus. Fitoterapia. 2002 Apr;73(2):171-3. |
| Molecular Formula | C18H23NO6 |
|---|---|
| Molecular Weight | 349.37800 |
| Exact Mass | 349.15300 |
| PSA | 88.60000 |
| LogP | 0.26360 |
| InChIKey | NOQVBHHOUTTZGE-AJDQYRSESA-N |
| SMILES | CC=C1CC2(CO)OC2(C)C(=O)OCC2=CCN3CCC(OC1=O)C23 |