3-Nitro-5-(trifluoromethyl)aniline structure
|
Common Name | 3-Nitro-5-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 401-94-5 | Molecular Weight | 206.122 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 280.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F3N2O2 | Melting Point | 77-81ºC | |
| MSDS | N/A | Flash Point | 123.5±27.3 °C | |
| Name | 3-Nitro-5-(trifluoromethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 280.7±40.0 °C at 760 mmHg |
| Melting Point | 77-81ºC |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.122 |
| Flash Point | 123.5±27.3 °C |
| Exact Mass | 206.030319 |
| PSA | 71.84000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | LTVWXWWSCLXXAT-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])cc(C(F)(F)F)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant;Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | 2811.0 |
| HS Code | 2921420090 |
|
~%
3-Nitro-5-(trif... CAS#:401-94-5 |
| Literature: Journal of the American Chemical Society, , vol. 66, p. 1972 |
|
~%
3-Nitro-5-(trif... CAS#:401-94-5 |
| Literature: Journal of the American Chemical Society, , vol. 66, p. 1972 |
|
~%
3-Nitro-5-(trif... CAS#:401-94-5 |
| Literature: Journal of the American Chemical Society, , vol. 66, p. 1972 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00061229 |
| 3-Nitro-5-(trifluoromethyl)benzenamine |
| Benzenamine, 3-nitro-5-(trifluoromethyl)- |
| 3-Amino-5-Nitrobenzotrifluoride |
| WNR CZ EXFFF |
| 3-Nitro-5-(trifluoromethyl)aniline |