5'-DMT-N2-DMF-dG
Modify Date: 2025-08-21 15:57:53
5'-DMT-N2-DMF-dG structure
|
Common Name | 5'-DMT-N2-DMF-dG | ||
|---|---|---|---|---|
| CAS Number | 40094-22-2 | Molecular Weight | 624.68600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H36N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-DMT-N2-DMF-dG5'-O-DMT-2'-O-TBDMS-rI is a modified nucleoside. 5'-O-DMT-2'-O-TBDMS-rI can be used in the synthesis of deoxyribonucleic acid or nucleic acid. |
| Name | 5'-O-(4,4'-Dimethoxytrityl)-N2-dimethylformamidine-2'-deoxyguanosine |
|---|---|
| Synonym | More Synonyms |
| Description | 5'-O-DMT-2'-O-TBDMS-rI is a modified nucleoside. 5'-O-DMT-2'-O-TBDMS-rI can be used in the synthesis of deoxyribonucleic acid or nucleic acid. |
|---|---|
| Related Catalog |
| Molecular Formula | C34H36N6O6 |
|---|---|
| Molecular Weight | 624.68600 |
| Exact Mass | 624.27000 |
| PSA | 136.32000 |
| LogP | 4.01530 |
| InChIKey | YTRIMRXIMVGPAL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(=O)[nH]c(N=CN(C)C)nc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Storage condition | 2-8℃ |
| 5'-O-dimethoxytrityl-N(2)-N,N-dimethylaminomethylene-2'-deoxyguanosine |
| 5'-dimethoxytrityl-N2-dimethylformamidine-2'-deoxyguanosine |
| O5'-(4,4'-dimethoxy-trityl)-N2-(dimethylamino-methylene)-2'-deoxy-guanosine |
| 5'-O-dimethoxytrityl-N2-dimethylaminomethylidene-2'-deoxyguanosine |
| 5'-O-Bis-(4-methoxyphenyl)phenylmethyl-N(2)dimethylaminomethylen-2'-desoxyguanosin |
| 5'-DMT-N2-DMF-dG |