Doxorubicin-SMCC
Modify Date: 2025-10-07 19:57:41
Doxorubicin-SMCC structure
|
Common Name | Doxorubicin-SMCC | ||
|---|---|---|---|---|
| CAS Number | 400647-59-8 | Molecular Weight | 762.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H42N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Doxorubicin-SMCCDoxorubicin-SMCC is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Doxorubicin-SMCC |
|---|
| Description | Doxorubicin-SMCC is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C39H42N2O14 |
|---|---|
| Molecular Weight | 762.76 |
| InChIKey | OTQOQHVWNBKSGU-SAJDXUNTSA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3OC1CC(NC(=O)C2CCC(CN3C(=O)C=CC3=O)CC2)C(O)C(C)O1 |