4'-Fluoro-3'-nitroacetophenone structure
|
Common Name | 4'-Fluoro-3'-nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 400-93-1 | Molecular Weight | 183.137 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 261.2±20.0 °C at 760 mmHg | |
| Molecular Formula | C8H6FNO3 | Melting Point | 46-50 °C | |
| MSDS | Chinese USA | Flash Point | 111.7±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-Fluoro-3'-nitroacetophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 261.2±20.0 °C at 760 mmHg |
| Melting Point | 46-50 °C |
| Molecular Formula | C8H6FNO3 |
| Molecular Weight | 183.137 |
| Flash Point | 111.7±21.8 °C |
| Exact Mass | 183.033173 |
| PSA | 62.89000 |
| LogP | 1.24 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | PTCNZDJJIOLIKQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(F)c([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
|
~77%
4'-Fluoro-3'-ni... CAS#:400-93-1 |
| Literature: Wu, Yong-Jin; He, Huan; Sun, Li-Qiang; Wu, Dedong; Gao, Qi; Li, Hui-Yin Bioorganic and Medicinal Chemistry Letters, 2003 , vol. 13, # 10 p. 1725 - 1728 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-Acetyl-1-fluoro-2-nitrobenzene |
| MFCD00115369 |
| ethanone, 1-(4-fluoro-3-nitrophenyl)- |
| 4'-Fluor-3'-nitroacetophenon |
| WNR BF EV1 |
| 4‘-Fluoro-3‘-nitroacetophenone |
| 1-(4-Fluoro-3-nitrophenyl)ethanone |
| 3-Acetyl-6-fluoronitrobenzene |