3-Methyl-1-(2-nitrophenyl)piperazine
Modify Date: 2025-08-25 09:20:35
3-Methyl-1-(2-nitrophenyl)piperazine structure
|
Common Name | 3-Methyl-1-(2-nitrophenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 398470-53-6 | Molecular Weight | 221.25600 | |
| Density | 1.167g/cm3 | Boiling Point | 371.5ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | 3-Methyl-1-(2-nitrophenyl)piperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 371.5ºC at 760 mmHg |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.25600 |
| Flash Point | 178.5ºC |
| Exact Mass | 221.11600 |
| PSA | 61.09000 |
| LogP | 2.30990 |
| Index of Refraction | 1.557 |
| InChIKey | JLCKZYKOWUVIPC-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccccc2[N+](=O)[O-])CCN1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-methyl-1-(2-nitrophenyl)piperazine |