(((4-methylphenyl)sulfonyl)oxy)acetic acid structure
|
Common Name | (((4-methylphenyl)sulfonyl)oxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 39794-77-9 | Molecular Weight | 230.23800 | |
| Density | 1.395g/cm3 | Boiling Point | 424.3ºC at 760 mmHg | |
| Molecular Formula | C9H10O5S | Melting Point | 140 °C | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | 2-(4-methylphenyl)sulfonyloxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395g/cm3 |
|---|---|
| Boiling Point | 424.3ºC at 760 mmHg |
| Melting Point | 140 °C |
| Molecular Formula | C9H10O5S |
| Molecular Weight | 230.23800 |
| Flash Point | 210.4ºC |
| Exact Mass | 230.02500 |
| PSA | 89.05000 |
| LogP | 1.86570 |
| Index of Refraction | 1.553 |
| InChIKey | NSORSORRXHLKQV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Tosylessigsaeure |
| MFCD00021764 |
| 2-(p-Toluenesulfonyloxy)acetic Acid |
| tosyloxyacetic acid |
| p-Toluolsulfonyloxyessigsaeure |
| Tosylglycolic Acid |